| product Name |
Octadecanoic acid, ester with 2,2-bis(hydroxymethyl)-1,3-propanediol |
| Synonyms |
Pentaerythritol stearate; Stearic acid, ester with pentaerythritol; octadecanoic acid - 2,2-bis(hydroxymethyl)propane-1,3-diol (1:1) |
| Molecular Formula |
C23H48O6 |
| Molecular Weight |
420.6236 |
| InChI |
InChI=1/C18H36O2.C5H12O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;6-1-5(2-7,3-8)4-9/h2-17H2,1H3,(H,19,20);6-9H,1-4H2 |
| CAS Registry Number |
8045-34-9 |
| EINECS |
232-457-9 |
| Molecular Structure |
|
| Boiling point |
359.4°C at 760 mmHg |
| Flash point |
162.4°C |
| Vapour Pressur |
8.58E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|