product Name |
2-(1-Naphthyl)-5-phenyl-1,3,4-oxadiazole |
Synonyms |
-; 2-(naphthalen-1-yl)-5-phenyl-1,3,4-oxadiazole |
Molecular Formula |
C18H12N2O |
Molecular Weight |
272.3007 |
InChI |
InChI=1/C18H12N2O/c1-2-8-14(9-3-1)17-19-20-18(21-17)16-12-6-10-13-7-4-5-11-15(13)16/h1-12H |
CAS Registry Number |
897-18-7 |
EINECS |
212-979-3 |
Molecular Structure |
|
Density |
1.219g/cm3 |
Boiling point |
472.8°C at 760 mmHg |
Refractive index |
1.652 |
Flash point |
241.3°C |
Vapour Pressur |
1.18E-08mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|