product Name |
2,5-dibenzylidenecyclopentanone |
Synonyms |
Cyclopentanone, 2,5-bis(phenylmethylene)- (9CI); 2,5-Dibenzylidenecyclopentanone; NSC 71885; Cyclopentanone, 2,5-dibenzylidene- (8CI); (2E,5E)-2,5-bis(phenylmethylidene)cyclopentanone; (2Z,5E)-2,5-bis(phenylmethylidene)cyclopentanone |
Molecular Formula |
C19H16O |
Molecular Weight |
260.3297 |
InChI |
InChI=1/C19H16O/c20-19-17(13-15-7-3-1-4-8-15)11-12-18(19)14-16-9-5-2-6-10-16/h1-10,13-14H,11-12H2/b17-13-,18-14+ |
CAS Registry Number |
895-80-7 |
Molecular Structure |
|
Density |
1.179g/cm3 |
Boiling point |
462.9°C at 760 mmHg |
Refractive index |
1.69 |
Flash point |
205.7°C |
Vapour Pressur |
9.53E-09mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|