product Name |
trans,trans-1,4-Diphenyl-1,3-butadiene |
Synonyms |
DPB; 1,4-Diphenyl-1,3-butadiene; bistyryl; 1,1'-(1Z,3Z)-buta-1,3-diene-1,4-diyldibenzene |
Molecular Formula |
C16H14 |
Molecular Weight |
206.2824 |
InChI |
InChI=1/C16H14/c1-3-9-15(10-4-1)13-7-8-14-16-11-5-2-6-12-16/h1-14H/b13-7-,14-8- |
CAS Registry Number |
886-65-7 |
EINECS |
212-952-6 |
Molecular Structure |
|
Density |
1.035g/cm3 |
Melting point |
151-154℃ |
Boiling point |
367°C at 760 mmHg |
Refractive index |
1.653 |
Flash point |
190°C |
Vapour Pressur |
2.97E-05mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|