product Name |
Nitrophenylphenol |
Synonyms |
4-Hydroxy-3-Nitrodiphenyl; 3-nitrobiphenyl-4-ol |
Molecular Formula |
C12H9NO3 |
Molecular Weight |
215.2048 |
InChI |
InChI=1/C12H9NO3/c14-12-7-6-10(8-11(12)13(15)16)9-4-2-1-3-5-9/h1-8,14H |
CAS Registry Number |
885-82-5 |
EINECS |
212-946-3 |
Molecular Structure |
|
Density |
1.304g/cm3 |
Boiling point |
338.5°C at 760 mmHg |
Refractive index |
1.637 |
Flash point |
145.1°C |
Vapour Pressur |
4.98E-05mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|