product Name |
4,4'-Dimethylbenzhydrol |
Synonyms |
Bis(p-tolyl) carbinol~4,4-Dimethyldiphenylmethanol; bis(4-methylphenyl)methanol |
Molecular Formula |
C15H16O |
Molecular Weight |
212.2869 |
InChI |
InChI=1/C15H16O/c1-11-3-7-13(8-4-11)15(16)14-9-5-12(2)6-10-14/h3-10,15-16H,1-2H3 |
CAS Registry Number |
885-77-8 |
Molecular Structure |
|
Density |
1.063g/cm3 |
Boiling point |
352.7°C at 760 mmHg |
Refractive index |
1.583 |
Flash point |
149.2°C |
Vapour Pressur |
1.4E-05mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|