| product Name |
N-(3-hydroxypropyl)phthalimide |
| Synonyms |
3-Phthalimidopropanol; 2-(3-hydroxypropyl)-1H-isoindole-1,3(2H)-dione |
| Molecular Formula |
C11H11NO3 |
| Molecular Weight |
205.2099 |
| InChI |
InChI=1/C11H11NO3/c13-7-3-6-12-10(14)8-4-1-2-5-9(8)11(12)15/h1-2,4-5,13H,3,6-7H2 |
| CAS Registry Number |
883-44-3 |
| EINECS |
212-931-1 |
| Molecular Structure |
|
| Density |
1.331g/cm3 |
| Melting point |
74-76℃ |
| Boiling point |
376.5°C at 760 mmHg |
| Refractive index |
1.605 |
| Flash point |
181.5°C |
| Vapour Pressur |
2.44E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
