| product Name |
beta,3-Dinitrostyrene |
| Synonyms |
2-Nitro-1-(3-nitrophenyl)ethene~3-Nitro-beta-nitrostyrene; 1-nitro-3-[(E)-2-nitroethenyl]benzene; 1-nitro-3-[(Z)-2-nitrovinyl]benzene |
| Molecular Formula |
C8H6N2O4 |
| Molecular Weight |
194.1442 |
| InChI |
InChI=1/C8H6N2O4/c11-9(12)5-4-7-2-1-3-8(6-7)10(13)14/h1-6H/b5-4- |
| CAS Registry Number |
882-26-8 |
| Molecular Structure |
|
| Density |
1.401g/cm3 |
| Boiling point |
345.6°C at 760 mmHg |
| Refractive index |
1.642 |
| Flash point |
175.4°C |
| Vapour Pressur |
0.000121mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
