| product Name |
Dimethyl 2,5-pyridinedicarboxylate |
| Synonyms |
Dimethyl pyridine-2,5-dicarboxylate; Dimethyl isocinchomeronate~Pyridine-2,5-dicarboxylic acid dimethyl ester |
| Molecular Formula |
C9H9NO4 |
| Molecular Weight |
195.1721 |
| InChI |
InChI=1/C9H9NO4/c1-13-8(11)6-3-4-7(10-5-6)9(12)14-2/h3-5H,1-2H3 |
| CAS Registry Number |
881-86-7 |
| Molecular Structure |
|
| Density |
1.231g/cm3 |
| Melting point |
213-217℃ |
| Boiling point |
302.9°C at 760 mmHg |
| Refractive index |
1.516 |
| Flash point |
137°C |
| Vapour Pressur |
0.000961mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
