product Name |
8-nitroquinaldine |
Synonyms |
Nitroquinaldine; 2-Methyl-8-nitroquinoline |
Molecular Formula |
C10H8N2O2 |
Molecular Weight |
188.1827 |
InChI |
InChI=1/C10H8N2O2/c1-7-5-6-8-3-2-4-9(12(13)14)10(8)11-7/h2-6H,1H3 |
CAS Registry Number |
881-07-2 |
EINECS |
212-919-6 |
Molecular Structure |
|
Density |
1.298g/cm3 |
Boiling point |
323.8°C at 760 mmHg |
Refractive index |
1.661 |
Flash point |
149.6°C |
Vapour Pressur |
0.000483mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
R40:Possible risks of irreversible effects.;
|
Safety Description |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|