product Name |
2-Methyl-1-nitronaphthalene |
Synonyms |
Naphthalene, 2-methyl-1-nitro-; 1-Nitro-2-methylnaphthalene; 4-05-00-01698 (Beilstein Handbook Reference); BRN 1954310; CCRIS 4680; NSC 7516 |
Molecular Formula |
C11H9NO2 |
Molecular Weight |
187.1947 |
InChI |
InChI=1/C11H9NO2/c1-8-6-7-9-4-2-3-5-10(9)11(8)12(13)14/h2-7H,1H3 |
CAS Registry Number |
881-03-8 |
EINECS |
212-917-5 |
Molecular Structure |
|
Density |
1.234g/cm3 |
Melting point |
79-82℃ |
Boiling point |
320.5°C at 760 mmHg |
Refractive index |
1.652 |
Flash point |
150.4°C |
Vapour Pressur |
0.000594mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|