| product Name |
Dipiperidinomethane |
| Synonyms |
1,1-Methylenedipiperidine; 1,1'-methanediyldipiperidine; 1,1'-methanediyldipiperidinium |
| Molecular Formula |
C11H24N2 |
| Molecular Weight |
184.3206 |
| InChI |
InChI=1/C11H22N2/c1-3-7-12(8-4-1)11-13-9-5-2-6-10-13/h1-11H2/p+2 |
| CAS Registry Number |
880-09-1 |
| EINECS |
212-911-2 |
| Molecular Structure |
|
| Boiling point |
245.3°C at 760 mmHg |
| Flash point |
91.7°C |
| Vapour Pressur |
0.0289mmHg at 25°C |
| Hazard Symbols |
Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|