| product Name |
hydroquinone, compound with piperazine (1:1) |
| Synonyms |
1,4-Benzenediol, compd. with piperazine (1:1); Hydroquinone, compound with piperazine (1:1); benzene-1,4-diol - piperazine (1:1) |
| Molecular Formula |
C10H16N2O2 |
| Molecular Weight |
196.2462 |
| InChI |
InChI=1/C6H6O2.C4H10N2/c7-5-1-2-6(8)4-3-5;1-2-6-4-3-5-1/h1-4,7-8H;5-6H,1-4H2 |
| CAS Registry Number |
878-28-4 |
| EINECS |
212-901-8 |
| Molecular Structure |
|
| Boiling point |
286°C at 760 mmHg |
| Flash point |
141.6°C |
| Vapour Pressur |
0.00157mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|
