| product Name |
N,N'-Diacetylethylenediamine |
| Synonyms |
N,N-Diacetylethylenediamine; N,N'-ethane-1,2-diyldiacetamide |
| Molecular Formula |
C6H12N2O2 |
| Molecular Weight |
144.1717 |
| InChI |
InChI=1/C6H12N2O2/c1-5(9)7-3-4-8-6(2)10/h3-4H2,1-2H3,(H,7,9)(H,8,10) |
| CAS Registry Number |
871-78-3 |
| EINECS |
212-811-9 |
| Molecular Structure |
|
| Density |
1.033g/cm3 |
| Boiling point |
438.7°C at 760 mmHg |
| Refractive index |
1.444 |
| Flash point |
214.8°C |
| Vapour Pressur |
6.74E-08mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|