product Name |
N,N'-Diacetylethylenediamine |
Synonyms |
N,N-Diacetylethylenediamine; N,N'-ethane-1,2-diyldiacetamide |
Molecular Formula |
C6H12N2O2 |
Molecular Weight |
144.1717 |
InChI |
InChI=1/C6H12N2O2/c1-5(9)7-3-4-8-6(2)10/h3-4H2,1-2H3,(H,7,9)(H,8,10) |
CAS Registry Number |
871-78-3 |
EINECS |
212-811-9 |
Molecular Structure |
|
Density |
1.033g/cm3 |
Boiling point |
438.7°C at 760 mmHg |
Refractive index |
1.444 |
Flash point |
214.8°C |
Vapour Pressur |
6.74E-08mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|