| product Name |
2-Amino-1-propene-1,1,3-tricarbonitrile |
| Molecular Formula |
C6H4N4 |
| Molecular Weight |
132.1228 |
| InChI |
InChI=1/C6H4N4/c7-2-1-6(10)5(3-8)4-9/h5,10H,1H2/b10-6+ |
| CAS Registry Number |
868-54-2 |
| EINECS |
212-777-5 |
| Molecular Structure |
|
| Density |
1.13g/cm3 |
| Melting point |
171-173℃ |
| Boiling point |
454.9°C at 760 mmHg |
| Refractive index |
1.565 |
| Flash point |
228.9°C |
| Vapour Pressur |
1.84E-08mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Description |
S36/37:Wear suitable protective clothing and gloves.;
|
|
