| product Name |
Hydroxybutyl methyl cellulose |
| Synonyms |
Cellulose, hydroxybutyl methyl ether; Hydroxybutyl methylcellulose; 2-hydroxybutyl 2,3,6-tris-O-(2-hydroxybutyl)-4-O-[2,3,4,6-tetrakis-O-(2-hydroxybutyl)hexopyranosyl]hexopyranoside - methyl 2,3,6-tri-O-methyl-4-O-(2,3,4,6-tetra-O-methylhexopyranosyl)hexopyranoside (1:1) |
| Molecular Formula |
C64H124O30 |
| Molecular Weight |
1373.6514 |
| InChI |
InChI=1/C44H86O19.C20H38O11/c1-9-27(45)17-53-25-35-37(55-19-29(47)11-3)39(56-20-30(48)12-4)42(59-23-33(51)15-7)44(62-35)63-38-36(26-54-18-28(46)10-2)61-43(60-24-34(52)16-8)41(58-22-32(50)14-6)40(38)57-21-31(49)13-5;1-21-9-11-13(23-3)15(24-4)18(27-7)20(30-11)31-14-12(10-22-2)29-19(28-8)17(26-6)16(14)25-5/h27-52H,9-26H2,1-8H3;11-20H,9-10H2,1-8H3 |
| CAS Registry Number |
9041-56-9 |
| Molecular Structure |
|
| Boiling point |
944.4°C at 760 mmHg |
| Flash point |
525°C |
| Vapour Pressur |
0mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|