| product Name |
3',4',5,7-Tetramethoxyflavone |
| Synonyms |
Luteolin tetramethyl ether; 2-(3,4-dimethoxyphenyl)-5,7-dimethoxy-4H-chromen-4-one |
| Molecular Formula |
C19H18O6 |
| Molecular Weight |
342.3426 |
| InChI |
InChI=1/C19H18O6/c1-21-12-8-17(24-4)19-13(20)10-15(25-18(19)9-12)11-5-6-14(22-2)16(7-11)23-3/h5-10H,1-4H3 |
| CAS Registry Number |
855-97-0 |
| Molecular Structure |
|
| Density |
1.243g/cm3 |
| Boiling point |
528.8°C at 760 mmHg |
| Refractive index |
1.574 |
| Flash point |
233.9°C |
| Vapour Pressur |
2.86E-11mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|