| product Name |
3',5-Dihydroxy-4',6,7-trimethoxyflavone |
| Synonyms |
Eupatorin; 5-hydroxy-2-(3-hydroxy-4-methoxyphenyl)-6,7-dimethoxy-4H-chromen-4-one |
| Molecular Formula |
C18H16O7 |
| Molecular Weight |
344.3154 |
| InChI |
InChI=1/C18H16O7/c1-22-12-5-4-9(6-10(12)19)13-7-11(20)16-14(25-13)8-15(23-2)18(24-3)17(16)21/h4-8,19,21H,1-3H3 |
| CAS Registry Number |
855-96-9 |
| Molecular Structure |
|
| Density |
1.387g/cm3 |
| Boiling point |
587°C at 760 mmHg |
| Refractive index |
1.627 |
| Flash point |
216°C |
| Vapour Pressur |
2.24E-14mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|