product Name |
Decafluorobenzophenone |
Synonyms |
- |
Molecular Formula |
C13F10O |
Molecular Weight |
362.12 |
InChI |
InChI=1/C13F10O/c14-3-1(4(15)8(19)11(22)7(3)18)13(24)2-5(16)9(20)12(23)10(21)6(2)17 |
CAS Registry Number |
853-39-4 |
EINECS |
212-717-8 |
Molecular Structure |
|
Melting point |
92-94℃ |
Hazard Symbols |
Xi:Irritant;
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|