product Name |
10,11-Dihydro-5H-dibenzo[a,d]cycloheptene |
Synonyms |
Dibenzosuberane; 10,11-dihydro-5H-dibenzo[a,d][7]annulene |
Molecular Formula |
C15H14 |
Molecular Weight |
194.2717 |
InChI |
InChI=1/C15H14/c1-3-7-14-11-15-8-4-2-6-13(15)10-9-12(14)5-1/h1-8H,9-11H2 |
CAS Registry Number |
833-48-7 |
EINECS |
212-630-5 |
Molecular Structure |
|
Density |
1.056g/cm3 |
Melting point |
72-76℃ |
Boiling point |
356.7°C at 760 mmHg |
Refractive index |
1.601 |
Flash point |
135.1°C |
Vapour Pressur |
5.89E-05mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|