| product Name |
2,4,6-Trimethoxyacetophenone |
| Synonyms |
Ethanone, 1-(2,4,6-trimethoxyphenyl)-; 1-(2,4,6-Trimethoxyphenyl)ethanone |
| Molecular Formula |
C11H14O4 |
| Molecular Weight |
210.2265 |
| InChI |
InChI=1/C11H14O4/c1-7(12)11-9(14-3)5-8(13-2)6-10(11)15-4/h5-6H,1-4H3 |
| CAS Registry Number |
832-58-6 |
| Molecular Structure |
|
| Density |
1.089g/cm3 |
| Boiling point |
343°C at 760 mmHg |
| Refractive index |
1.495 |
| Flash point |
152°C |
| Vapour Pressur |
7.27E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
