| product Name |
2,6-dimethyl-1,3-dioxan-4-ol acetate |
| Synonyms |
2,6-Dimethyl-1,3-dioxan-4-ol acetate,mixture of cis and trans; 2,6-dimethyl-1,3-dioxan-4-yl acetate |
| Molecular Formula |
C8H14O4 |
| Molecular Weight |
174.1944 |
| InChI |
InChI=1/C8H14O4/c1-5-4-8(11-6(2)9)12-7(3)10-5/h5,7-8H,4H2,1-3H3 |
| CAS Registry Number |
828-00-2 |
| EINECS |
212-579-9 |
| Molecular Structure |
|
| Density |
1.08g/cm3 |
| Boiling point |
212.3°C at 760 mmHg |
| Refractive index |
1.44 |
| Flash point |
83.3°C |
| Vapour Pressur |
0.174mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|
