| product Name |
alpha-Cyclopropyl-4-fluorobenzyl alcohol |
| Synonyms |
Cyclopropyl(4-fluorophenyl)methanol; (R)-cyclopropyl(4-fluorophenyl)methanol; (S)-cyclopropyl(4-fluorophenyl)methanol |
| Molecular Formula |
C10H11FO |
| Molecular Weight |
166.1921 |
| InChI |
InChI=1/C10H11FO/c11-9-5-3-8(4-6-9)10(12)7-1-2-7/h3-7,10,12H,1-2H2/t10-/m0/s1 |
| CAS Registry Number |
827-88-3 |
| EINECS |
212-576-2 |
| Molecular Structure |
|
| Density |
1.24g/cm3 |
| Boiling point |
250.8°C at 760 mmHg |
| Refractive index |
1.578 |
| Flash point |
128.9°C |
| Vapour Pressur |
0.0111mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|