| product Name |
Thianaphthene-1,1-dioxide |
| Synonyms |
Thianaphthene 1,1-dioxide; Benzo[b]thiophene 1,1-dioxide; 1-benzothiophene 1,1-dioxide |
| Molecular Formula |
C8H6O2S |
| Molecular Weight |
166.197 |
| InChI |
InChI=1/C8H6O2S/c9-11(10)6-5-7-3-1-2-4-8(7)11/h1-6H |
| CAS Registry Number |
825-44-5 |
| EINECS |
212-544-8 |
| Molecular Structure |
|
| Density |
1.403g/cm3 |
| Melting point |
137-138℃ |
| Boiling point |
371.1°C at 760 mmHg |
| Refractive index |
1.64 |
| Flash point |
244°C |
| Vapour Pressur |
2.25E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
