| product Name |
2,5-Dichlorohydroquinone |
| Synonyms |
2,5-Dichloro-1,4-dihydroxybenzene; 2,5-Dichloro-1,4-hydroquinone; 2,5-Dichloro-p-benzohydroquinone; 2,5-Dichloro-p-hydroquinone; CCRIS 5677; NSC 48667; 1,4-Benzenediol, 2,5-dichloro-; Hydroquinone, 2,5-dichloro- (8CI); 2,5-dichlorobenzene-1,4-diol |
| Molecular Formula |
C6H4Cl2O2 |
| Molecular Weight |
179.0008 |
| InChI |
InChI=1/C6H4Cl2O2/c7-3-1-5(9)4(8)2-6(3)10/h1-2,9-10H |
| CAS Registry Number |
824-69-1 |
| EINECS |
212-533-8 |
| Molecular Structure |
|
| Density |
1.624g/cm3 |
| Melting point |
167-174℃ |
| Boiling point |
274°C at 760 mmHg |
| Refractive index |
1.642 |
| Flash point |
119.5°C |
| Vapour Pressur |
0.00332mmHg at 25°C |
| Hazard Symbols |
 C:Corrosive;
|
| Risk Codes |
R34:Causes burns.;
|
| Safety Description |
S25:Avoid contact with eyes.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
