product Name |
1-(chloromethyl)-2,4-dimethylbenzene |
Synonyms |
2,4-Dimethylbenzyl chloride; 4-(Chloromethyl)-m-xylene |
Molecular Formula |
C9H11Cl |
Molecular Weight |
154.6366 |
InChI |
InChI=1/C9H11Cl/c1-7-3-4-9(6-10)8(2)5-7/h3-5H,6H2,1-2H3 |
CAS Registry Number |
824-55-5 |
EINECS |
212-531-7 |
Molecular Structure |
|
Density |
1.033g/cm3 |
Boiling point |
215.5°C at 760 mmHg |
Refractive index |
1.522 |
Flash point |
86.5°C |
Vapour Pressur |
0.216mmHg at 25°C |
Hazard Symbols |
C:Corrosive;
|
Risk Codes |
R34:Causes burns.;
R36:Irritating to eyes.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|