| product Name |
Cyclohexyl methyl ketone |
| Synonyms |
Acetylcyclohexane~Hexahydroacetophenone~Methyl cyclohexyl ketone; Acetylcyclohexane; 1-cyclohexylethanone; 1-CYCLOHEXYLETHAN-1-ONE |
| Molecular Formula |
C8H14O |
| Molecular Weight |
126.1962 |
| InChI |
InChI=1/C8H14O/c1-7(9)8-5-3-2-4-6-8/h8H,2-6H2,1H3 |
| CAS Registry Number |
823-76-7 |
| EINECS |
212-517-0 |
| Molecular Structure |
|
| Density |
0.916g/cm3 |
| Boiling point |
181.5°C at 760 mmHg |
| Refractive index |
1.448 |
| Flash point |
61.4°C |
| Vapour Pressur |
0.849mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/38:Irritating to eyes and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
