| product Name |
delta-Hexanolactone |
| Synonyms |
delta-Hexalactone~5-Hydroxyhexanoic acid lactone; 6-methyltetrahydro-2H-pyran-2-one; (6S)-6-methyltetrahydro-2H-pyran-2-one |
| Molecular Formula |
C6H10O2 |
| Molecular Weight |
114.1424 |
| InChI |
InChI=1/C6H10O2/c1-5-3-2-4-6(7)8-5/h5H,2-4H2,1H3/t5-/m0/s1 |
| CAS Registry Number |
823-22-3 |
| EINECS |
212-511-8 |
| Molecular Structure |
|
| Density |
1.001g/cm3 |
| Boiling point |
215.7°C at 760 mmHg |
| Refractive index |
1.43 |
| Flash point |
79.8°C |
| Vapour Pressur |
0.145mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|