product Name |
delta-Hexanolactone |
Synonyms |
delta-Hexalactone~5-Hydroxyhexanoic acid lactone; 6-methyltetrahydro-2H-pyran-2-one; (6S)-6-methyltetrahydro-2H-pyran-2-one |
Molecular Formula |
C6H10O2 |
Molecular Weight |
114.1424 |
InChI |
InChI=1/C6H10O2/c1-5-3-2-4-6(7)8-5/h5H,2-4H2,1H3/t5-/m0/s1 |
CAS Registry Number |
823-22-3 |
EINECS |
212-511-8 |
Molecular Structure |
|
Density |
1.001g/cm3 |
Boiling point |
215.7°C at 760 mmHg |
Refractive index |
1.43 |
Flash point |
79.8°C |
Vapour Pressur |
0.145mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|