product Name |
trans-1,2-Dichlorocyclohexane |
Synonyms |
Dychlorocyclohexane; trans-1,2-Dychlorocyclohexane; 1,2-dichlorocyclohexane; (1R,2R)-1,2-dichlorocyclohexane; (1R)-1,2-dichlorocyclohexane |
Molecular Formula |
C6H10Cl2 |
Molecular Weight |
153.0496 |
InChI |
InChI=1/C6H10Cl2/c7-5-3-1-2-4-6(5)8/h5-6H,1-4H2/t5-,6?/m1/s1 |
CAS Registry Number |
822-86-6 |
EINECS |
212-503-4 |
Molecular Structure |
|
Density |
1.14g/cm3 |
Boiling point |
198°C at 760 mmHg |
Refractive index |
1.472 |
Flash point |
66.1°C |
Vapour Pressur |
0.518mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|