| product Name |
8-Pentadecanone |
| Synonyms |
Di-n-heptyl ketone; pentadecane-8-one; pentadecan-8-one |
| Molecular Formula |
C15H30O |
| Molecular Weight |
226.3981 |
| InChI |
InChI=1/C15H30O/c1-3-5-7-9-11-13-15(16)14-12-10-8-6-4-2/h3-14H2,1-2H3 |
| CAS Registry Number |
818-23-5 |
| EINECS |
212-450-7 |
| Molecular Structure |
|
| Density |
0.828g/cm3 |
| Melting point |
40-44℃ |
| Boiling point |
292.6°C at 760 mmHg |
| Refractive index |
1.436 |
| Flash point |
83.1°C |
| Vapour Pressur |
0.00182mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|