| product Name |
Tris(2-chloroethyl)amine hydrochloride |
| Synonyms |
2,2,2-Trichlorotriethylamine hydrochloride; 2-chloro-N,N-bis(2-chloroethyl)ethanaminium |
| Molecular Formula |
C6H13Cl3N |
| Molecular Weight |
205.5326 |
| InChI |
InChI=1/C6H12Cl3N/c7-1-4-10(5-2-8)6-3-9/h1-6H2/p+1 |
| CAS Registry Number |
817-09-4 |
| EINECS |
212-442-3 |
| Molecular Structure |
|
| Melting point |
127-132℃ |
| Boiling point |
156.2°C at 760 mmHg |
| Flash point |
48.3°C |
| Vapour Pressur |
2.92mmHg at 25°C |
| Hazard Symbols |
 T+:Very toxic;
|
| Risk Codes |
R26/27/28:Very toxic by inhalation, in contact with skin and if swallowed.;
R33:Danger of cummulative effects.;
R40:Possible risks of irreversible effects.;
|
| Safety Description |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|
