| product Name |
Triacetylmethane |
| Synonyms |
methine triacetate; 3-acetylpentane-2,4-dione; 3-(1-hydroxyethylidene)pentane-2,4-dione |
| Molecular Formula |
C7H10O3 |
| Molecular Weight |
142.1525 |
| InChI |
InChI=1/C7H10O3/c1-4(8)7(5(2)9)6(3)10/h8H,1-3H3 |
| CAS Registry Number |
815-68-9 |
| EINECS |
212-422-4 |
| Molecular Structure |
|
| Density |
1.101g/cm3 |
| Boiling point |
298.3°C at 760 mmHg |
| Refractive index |
1.467 |
| Flash point |
148.4°C |
| Vapour Pressur |
0.000129mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
