| product Name |
Acryloyl chloride |
| Synonyms |
Propenoyl chloride; Acrylyl chloride; prop-2-enoyl chloride; Acyloyl chloride |
| Molecular Formula |
C3H3OCl |
| Molecular Weight |
90.5083 |
| InChI |
InChI=1/C3H3ClO/c1-2-3(4)5/h2H,1H2 |
| CAS Registry Number |
814-68-6 |
| EINECS |
212-399-0 |
| Molecular Structure |
|
| Density |
1.108g/cm3 |
| Boiling point |
75.5°C at 760 mmHg |
| Refractive index |
1.417 |
| Flash point |
16.1°C |
| Vapour Pressur |
105mmHg at 25°C |
| Hazard Symbols |
 F:Highly flammable;
 C:Corrosive;
|
| Risk Codes |
R11:Highly flammable.;
R34:Causes burns.;
|
| Safety Description |
S16:Keep away from sources of ignition - No smoking.;
S30:Never add water to this product.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
