product Name |
Isopulegol |
Synonyms |
1-Methyl-4-isopropenylcyclohexan-3-ol; p-menth-8-en-3-ol; (1R,2S,5R)-5-methyl-2-(prop-1-en-2-yl)cyclohexanol |
Molecular Formula |
C10H18O |
Molecular Weight |
154.2493 |
InChI |
InChI=1/C10H18O/c1-7(2)9-5-4-8(3)6-10(9)11/h8-11H,1,4-6H2,2-3H3/t8-,9+,10-/m1/s1 |
CAS Registry Number |
89-79-2 |
EINECS |
201-940-6 |
Molecular Structure |
|
Density |
0.912g/cm3 |
Boiling point |
197°C at 760 mmHg |
Refractive index |
1.472 |
Flash point |
78.3°C |
Vapour Pressur |
0.0993mmHg at 25°C |
Hazard Symbols |
Xn:Harmful;
|
Risk Codes |
R21/22:Harmful in contact with skin and if swallowed.;
|
Safety Description |
|
|