product Name |
Isopulegyl acetate, mixture of isomers |
Synonyms |
(1R,2R,5R)-5-methyl-2-(1-methylethenyl)cyclohexyl acetate; (1R,2R,5S)-5-methyl-2-(1-methylethenyl)cyclohexyl acetate; (1R,2S,5S)-5-methyl-2-(1-methylethenyl)cyclohexyl acetate |
Molecular Formula |
C12H20O2 |
Molecular Weight |
196.286 |
InChI |
InChI=1/C12H20O2/c1-8(2)11-6-5-9(3)7-12(11)14-10(4)13/h9,11-12H,1,5-7H2,2-4H3/t9-,11-,12+/m0/s1 |
CAS Registry Number |
89-49-6 |
Molecular Structure |
|
Density |
0.94g/cm3 |
Boiling point |
248°C at 760 mmHg |
Refractive index |
1.458 |
Flash point |
85.6°C |
Vapour Pressur |
0.0248mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|