product Name |
phthalamic acid |
Synonyms |
Phthalamic acid, (2-Carboxybenzamide); 2-Carboxybenzamide; 2-carbamoylbenzoic acid |
Molecular Formula |
C8H7NO3 |
Molecular Weight |
165.1461 |
InChI |
InChI=1/C8H7NO3/c9-7(10)5-3-1-2-4-6(5)8(11)12/h1-4H,(H2,9,10)(H,11,12) |
CAS Registry Number |
88-97-1 |
EINECS |
201-871-1 |
Molecular Structure |
|
Density |
1.368g/cm3 |
Boiling point |
394.2°C at 760 mmHg |
Refractive index |
1.615 |
Flash point |
192.2°C |
Vapour Pressur |
6.38E-07mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|