product Name |
2,5-dichloro-3-nitrobenzoic acid |
Synonyms |
Benzoic acid, 2,5-dichloro-3-nitro-; 2,5-Dichloro-3-nitrobenzoic acid; 2,5-Dichloro-4-nitrobenzoic acid; 2-09-00-00276 (Beilstein Handbook Reference); 3-Nitro-2,5-dichlorobenzoic acid; BRN 1976119; Caswell No. 312; Dinoben; EPA Pesticide Chemical Code 028101; Kyselina 2,5-dichlor-3-nitrobenzoova; Kyselina 2,5-dichlor-3-nitrobenzoova [Czech] |
Molecular Formula |
C7H3Cl2NO4 |
Molecular Weight |
236.009 |
InChI |
InChI=1/C7H3Cl2NO4/c8-3-1-4(7(11)12)6(9)5(2-3)10(13)14/h1-2H,(H,11,12) |
CAS Registry Number |
88-86-8 |
EINECS |
201-862-2 |
Molecular Structure |
|
Density |
1.713g/cm3 |
Melting point |
216-220℃ |
Boiling point |
366.5°C at 760 mmHg |
Refractive index |
1.638 |
Flash point |
175.5°C |
Vapour Pressur |
5.11E-06mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|