product Name |
Gramine |
Synonyms |
3-(Dimethylaminomethyl)indole |
Molecular Formula |
C11H14N2 |
Molecular Weight |
174.2423 |
InChI |
InChI=1/C11H14N2/c1-13(2)8-9-7-12-11-6-4-3-5-10(9)11/h3-7,12H,8H2,1-2H3 |
CAS Registry Number |
87-52-5 |
EINECS |
201-749-8 |
Molecular Structure |
|
Density |
1.099g/cm3 |
Melting point |
131-139℃ |
Boiling point |
293.9°C at 760 mmHg |
Refractive index |
1.63 |
Flash point |
131.5°C |
Water solubility |
PRACTICALLY INSOLUBLE |
Vapour Pressur |
0.00168mmHg at 25°C |
Hazard Symbols |
Xi:Irritant;
|
Risk Codes |
R36:Irritating to eyes.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S46:If swallowed, seek medical advice immediately and show this container or label.;
|
|