| product Name |
Gramine |
| Synonyms |
3-(Dimethylaminomethyl)indole |
| Molecular Formula |
C11H14N2 |
| Molecular Weight |
174.2423 |
| InChI |
InChI=1/C11H14N2/c1-13(2)8-9-7-12-11-6-4-3-5-10(9)11/h3-7,12H,8H2,1-2H3 |
| CAS Registry Number |
87-52-5 |
| EINECS |
201-749-8 |
| Molecular Structure |
|
| Density |
1.099g/cm3 |
| Melting point |
131-139℃ |
| Boiling point |
293.9°C at 760 mmHg |
| Refractive index |
1.63 |
| Flash point |
131.5°C |
| Water solubility |
PRACTICALLY INSOLUBLE |
| Vapour Pressur |
0.00168mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36:Irritating to eyes.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S46:If swallowed, seek medical advice immediately and show this container or label.;
|
|
