| product Name |
2-Hydroxycarbazole |
| Synonyms |
carbazol-2-ol; 9H-carbazol-2-ol |
| Molecular Formula |
C12H9NO |
| Molecular Weight |
183.206 |
| InChI |
InChI=1/C12H9NO/c14-8-5-6-10-9-3-1-2-4-11(9)13-12(10)7-8/h1-7,13-14H |
| CAS Registry Number |
86-79-3 |
| EINECS |
201-699-7 |
| Molecular Structure |
|
| Density |
1.362g/cm3 |
| Melting point |
273-275℃ |
| Boiling point |
431.4°C at 760 mmHg |
| Refractive index |
1.815 |
| Flash point |
214.7°C |
| Vapour Pressur |
4.78E-08mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
