product Name |
2'-Benzoylacetanilide |
Synonyms |
Acetamide, N-(2-benzoylphenyl)-; Acetamido-2 benzophenone; Acetamido-2 benzophenone [French]; N-(2-Benzoylphenyl)acetamide |
Molecular Formula |
C15H13NO2 |
Molecular Weight |
239.2692 |
InChI |
InChI=1/C15H13NO2/c1-11(17)16-14-10-6-5-9-13(14)15(18)12-7-3-2-4-8-12/h2-10H,1H3,(H,16,17) |
CAS Registry Number |
85-99-4 |
Molecular Structure |
|
Density |
1.192g/cm3 |
Melting point |
87-91 |
Boiling point |
477°C at 760 mmHg |
Refractive index |
1.618 |
Flash point |
196.2°C |
Vapour Pressur |
2.92E-09mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|