| product Name | 
    2'-Benzoylacetanilide  | 
   
  
  
    | Synonyms | 
    Acetamide, N-(2-benzoylphenyl)-; Acetamido-2 benzophenone; Acetamido-2 benzophenone [French]; N-(2-Benzoylphenyl)acetamide | 
   
  
  
  
    | Molecular Formula | 
    C15H13NO2 | 
   
  
  
  
    | Molecular Weight | 
    239.2692 | 
   
  
  
  
    | InChI | 
    InChI=1/C15H13NO2/c1-11(17)16-14-10-6-5-9-13(14)15(18)12-7-3-2-4-8-12/h2-10H,1H3,(H,16,17) | 
   
  
  
  
    | CAS Registry Number | 
    85-99-4 | 
   
  
  
  
  
    | Molecular Structure | 
     
                 | 
   
  
  
  
    | Density | 
    1.192g/cm3 | 
   
  
  
  
    | Melting point | 
    87-91 | 
   
  
  
   
    | Boiling point | 
    477°C at 760 mmHg | 
   
  
  
   
    | Refractive index | 
    1.618 | 
   
  
  
  
    | Flash point | 
    196.2°C | 
   
  
  
  
  
    | Vapour Pressur | 
    2.92E-09mmHg at 25°C | 
   
  
  
  
    | Hazard Symbols | 
    
       
       
       
 | 
   
  
  
  
    | Risk Codes | 
    
       
       
       
 | 
   
  
  
  
    | Safety Description | 
    
              S24/25:Avoid contact with skin and eyes.; 
       
       
 | 
   
  
  
 
 |