| product Name |
Sudan IV |
| Synonyms |
C.I. 26105; C.I. 258; C.I. Solvent Red 24; C.I. Solvent Red 24 (8CI); Scarlet red [NF X]; 1-[2-Methyl-4-(2-methylphenylazo)phenylazo]-2-naphthol; Lipid crimson; Scarlet Red; Solvent Red 24; scarlet R; 1-(2-methyl-4-(2-methylphenylazo)phenylazo)-2-naphthol; 1-((2-Methyl-4-((2-methylphenyl)azo)phenyl)azo)-2-naphthalenol; 1-((4-(o-tolylazo)-o-tolyl)azo)-2-naphtho; 1-((E)-(2-Methyl-4-[(E)-(2-methylphenyl)diazenyl]phenyl)diazenyl)-2-naphth; 1-(4-(o-Tolylazo)-o-tolylazo)-2-naphthol; 1-(4-o-tolylazo-o-tolylazo)-2-naphthol; 1-[[2-methyl-4-[(2-methylphenyl)azo]phenyl]azo]-2-naphthaleno; 2',3-Dimethyl-4-(2-hydroxynaphthylazo)azobenzene; (1Z)-1-({2-methyl-4-[(E)-(2-methylphenyl)diazenyl]phenyl}hydrazono)naphthalen-2(1H)-one; 1-({2-methyl-4-[(E)-(2-methylphenyl)diazenyl]phenyl}hydrazono)naphthalen-2(1H)-one; 1-[(E)-{2-methyl-4-[(E)-(2-methylphenyl)diazenyl]phenyl}diazenyl]naphthalen-2-ol; Solvent Red 24 |
| Molecular Formula |
C24H20N4O |
| Molecular Weight |
380.4418 |
| InChI |
InChI=1/C24H20N4O/c1-16-7-3-6-10-21(16)26-25-19-12-13-22(17(2)15-19)27-28-24-20-9-5-4-8-18(20)11-14-23(24)29/h3-15,29H,1-2H3/b26-25+,28-27+ |
| CAS Registry Number |
85-83-6 |
| EINECS |
201-635-8 |
| Molecular Structure |
|
| Density |
1.192g/cm3 |
| Melting point |
199℃ |
| Boiling point |
618.845°C at 760 mmHg |
| Refractive index |
1.645 |
| Flash point |
424.365°C |
| Vapour Pressur |
0mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|