| product Name | 
    Sudan IV | 
   
  
  
    | Synonyms | 
    C.I. 26105; C.I. 258; C.I. Solvent Red 24; C.I. Solvent Red 24 (8CI); Scarlet red [NF X]; 1-[2-Methyl-4-(2-methylphenylazo)phenylazo]-2-naphthol; Lipid crimson; Scarlet Red; Solvent Red  24; scarlet R; 1-(2-methyl-4-(2-methylphenylazo)phenylazo)-2-naphthol; 1-((2-Methyl-4-((2-methylphenyl)azo)phenyl)azo)-2-naphthalenol; 1-((4-(o-tolylazo)-o-tolyl)azo)-2-naphtho; 1-((E)-(2-Methyl-4-[(E)-(2-methylphenyl)diazenyl]phenyl)diazenyl)-2-naphth; 1-(4-(o-Tolylazo)-o-tolylazo)-2-naphthol; 1-(4-o-tolylazo-o-tolylazo)-2-naphthol; 1-[[2-methyl-4-[(2-methylphenyl)azo]phenyl]azo]-2-naphthaleno; 2',3-Dimethyl-4-(2-hydroxynaphthylazo)azobenzene; (1Z)-1-({2-methyl-4-[(E)-(2-methylphenyl)diazenyl]phenyl}hydrazono)naphthalen-2(1H)-one; 1-({2-methyl-4-[(E)-(2-methylphenyl)diazenyl]phenyl}hydrazono)naphthalen-2(1H)-one; 1-[(E)-{2-methyl-4-[(E)-(2-methylphenyl)diazenyl]phenyl}diazenyl]naphthalen-2-ol;  Solvent Red 24 | 
   
  
  
  
    | Molecular Formula | 
    C24H20N4O | 
   
  
  
  
    | Molecular Weight | 
    380.4418 | 
   
  
  
  
    | InChI | 
    InChI=1/C24H20N4O/c1-16-7-3-6-10-21(16)26-25-19-12-13-22(17(2)15-19)27-28-24-20-9-5-4-8-18(20)11-14-23(24)29/h3-15,29H,1-2H3/b26-25+,28-27+ | 
   
  
  
  
    | CAS Registry Number | 
    85-83-6 | 
   
  
  
  
    | EINECS | 
    201-635-8 | 
   
  
  
  
    | Molecular Structure | 
     
                 | 
   
  
  
  
    | Density | 
    1.192g/cm3 | 
   
  
  
  
    | Melting point | 
    199℃ | 
   
  
  
   
    | Boiling point | 
    618.845°C at 760 mmHg | 
   
  
  
   
    | Refractive index | 
    1.645 | 
   
  
  
  
    | Flash point | 
    424.365°C | 
   
  
  
  
  
    | Vapour Pressur | 
    0mmHg at 25°C | 
   
  
  
  
    | Hazard Symbols | 
    
       
       
       
 | 
   
  
  
  
    | Risk Codes | 
    
       
       
       
 | 
   
  
  
  
    | Safety Description | 
    
              S24/25:Avoid contact with skin and eyes.; 
       
       
 | 
   
  
  
 
 |