product Name |
6-Methoxy-8-nitroquinoline |
Synonyms |
6-Methoxy-8-Nitro quinoline; methyl 8-nitro-6-quinolyl ether; 6-Metoxy-8-nitroquinoline, 99% |
Molecular Formula |
C10H8N2O3 |
Molecular Weight |
204.1821 |
InChI |
InChI=1/C10H8N2O3/c1-15-8-5-7-3-2-4-11-10(7)9(6-8)12(13)14/h2-6H,1H3 |
CAS Registry Number |
85-81-4 |
EINECS |
201-633-7 |
Molecular Structure |
|
Density |
1.337g/cm3 |
Melting point |
158-162℃ |
Boiling point |
373.1°C at 760 mmHg |
Refractive index |
1.646 |
Flash point |
179.4°C |
Vapour Pressur |
1.97E-05mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|