product Name |
2-(4-Methylbenzoyl)benzoic acid |
Synonyms |
2-(p-Toluoyl)benzoic acid; 4-Methylbenzophenone-2-carboxylic acid; 2-[(4-methylphenyl)carbonyl]benzoate |
Molecular Formula |
C15H11O3 |
Molecular Weight |
239.2466 |
InChI |
InChI=1/C15H12O3/c1-10-6-8-11(9-7-10)14(16)12-4-2-3-5-13(12)15(17)18/h2-9H,1H3,(H,17,18)/p-1 |
CAS Registry Number |
85-55-2 |
EINECS |
201-614-3 |
Molecular Structure |
|
Melting point |
137-139℃ |
Boiling point |
457.1°C at 760 mmHg |
Flash point |
244.3°C |
Vapour Pressur |
3.79E-09mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|