| product Name |
2,6-Dihydroxyanthraquinone |
| Molecular Formula |
C14H8O4 |
| Molecular Weight |
240.2109 |
| InChI |
InChI=1/C14H8O4/c15-7-1-3-9-11(5-7)14(18)10-4-2-8(16)6-12(10)13(9)17/h1-6,15-16H |
| CAS Registry Number |
84-60-6 |
| EINECS |
201-544-3 |
| Molecular Structure |
|
| Density |
1.54g/cm3 |
| Melting point |
320℃ |
| Boiling point |
442.1°C at 760 mmHg |
| Refractive index |
1.732 |
| Flash point |
235.3°C |
| Vapour Pressur |
1.99E-08mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
