| product Name |
D-Lysergic acid hydrate |
| Synonyms |
9,10-Didehydro-6-methylergoline-8-carboxylic acid; lysergic acid; (8beta)-6-methyl-9,10-didehydroergoline-8-carboxylic acid; 6-methyl-9,10-didehydroergoline-8-carboxylic acid |
| Molecular Formula |
C16H16N2O2 |
| Molecular Weight |
268.3104 |
| InChI |
InChI=1/C16H16N2O2/c1-18-8-10(16(19)20)5-12-11-3-2-4-13-15(11)9(7-17-13)6-14(12)18/h2-5,7,10,14,17H,6,8H2,1H3,(H,19,20)/t10?,14-/m1/s1 |
| CAS Registry Number |
82-58-6 |
| EINECS |
201-431-9 |
| Molecular Structure |
|
| Density |
1.39g/cm3 |
| Melting point |
220℃ |
| Boiling point |
536.2°C at 760 mmHg |
| Refractive index |
1.725 |
| Flash point |
278.1°C |
| Vapour Pressur |
2.51E-12mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R40:Possible risks of irreversible effects.;
|
| Safety Description |
S13:Keep away from food, drink and animal feeding stuffs.;
S22:Do not inhale dust.;
S23:Do not inhale gas/fumes/vapour/spray.;
|
|
