| product Name |
1,5-Dichloroanthraquinone |
| Synonyms |
1,5-Dichloranthrachinon; 1,5-Dichloranthrachinon [Czech]; 1,5-Dichloro-9,10-anthraquinone; 9,10-Anthracenedione, 1,5-dichloro-; AI3-38301; NSC 13969; Anthraquinone, 1,5-dichloro-; 1,5-dichloroanthracene-9,10-dione |
| Molecular Formula |
C14H6Cl2O2 |
| Molecular Weight |
277.1022 |
| InChI |
InChI=1/C14H6Cl2O2/c15-9-5-1-3-7-11(9)14(18)8-4-2-6-10(16)12(8)13(7)17/h1-6H |
| CAS Registry Number |
82-46-2 |
| EINECS |
201-424-0 |
| Molecular Structure |
|
| Density |
1.514g/cm3 |
| Melting point |
245-250℃ |
| Boiling point |
455.2°C at 760 mmHg |
| Refractive index |
1.671 |
| Flash point |
191.7°C |
| Vapour Pressur |
1.79E-08mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
