| product Name |
Xanthene-9-carboxylic acid |
| Synonyms |
xanthoic acid; Methyl xanthene-9-carboxylate; 9-Xanthene carboxylic acid; Xomthene-9-carboxylic methylester acid; 9H-xanthene-9-carboxylic acid; 9H-xanthene-9-carboxylate |
| Molecular Formula |
C14H9O3 |
| Molecular Weight |
225.22 |
| InChI |
InChI=1/C14H10O3/c15-14(16)13-9-5-1-3-7-11(9)17-12-8-4-2-6-10(12)13/h1-8,13H,(H,15,16)/p-1 |
| CAS Registry Number |
82-07-5 |
| EINECS |
201-394-9 |
| Molecular Structure |
|
| Melting point |
221-225℃ |
| Boiling point |
391.3°C at 760 mmHg |
| Flash point |
153.1°C |
| Vapour Pressur |
7.99E-07mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
