| product Name |
Hydroxynitroanthraquinone; 97% |
| Synonyms |
1-Hydroxy-4-nitroanthraquinone; 1-Hydroxy-4-nitro-9,10-dihydroanthracene-9,10-dione; 1-hydroxy-4-nitroanthracene-9,10-dione |
| Molecular Formula |
C14H7NO5 |
| Molecular Weight |
269.2091 |
| InChI |
InChI=1/C14H7NO5/c16-10-6-5-9(15(19)20)11-12(10)14(18)8-4-2-1-3-7(8)13(11)17/h1-6,16H |
| CAS Registry Number |
81-65-2 |
| Molecular Structure |
|
| Density |
1.589g/cm3 |
| Melting point |
273℃ |
| Boiling point |
524.3°C at 760 mmHg |
| Refractive index |
1.723 |
| Flash point |
225.9°C |
| Vapour Pressur |
1.31E-11mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|